Cisapride hydrate
Cisapride (Propulsid, Alimix, Propulsin, Enteropride, Kinestase) acts directly as a selective serotonin 5-HT4 receptor agonist with IC50 of 0.483 μM. And It also acts indirectly as a parasympathomimetic.
| Trivial name | Propulsid, Alimix, Propulsin, Enteropride, Kinestase |
| Catalog Number | S4751 |
| Molecular Formula | C17H18N4O4 |
| CAS# | 260779-88-2 |
| SMILES | C1=CC=C(C=C1)C(C2C(C(C(O2)N3C=CC4=C(N=CN=C43)N)O)O)O |
| Size | 200mg |
| Supplier Page | http://www.selleckchem.com/products/cisapride-hydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cisapride-chemical-structure-S4751.gif |