Zamanic acid | MedChemExpress (MCE)
Zamanic acid is a potent inhibitor of glutathione reductase. Zamanic acid inhibits the growth of Mycobacterium tuberculosis in culture and has also been shown to have anti-inflammatory activity[1].
| Trivial name | Zamanic acid |
| Catalog Number | HY-N1054 |
| Alternative Name(s) | 3β-Hydroxyurs-30-p-E-hydroxycinnamoyl-12-en-28-oic acid |
| Research Area | Infection |
| CAS# | 260393-05-3 |
| Purity | ≥98.00% |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@@H](C)[C@H](COC(/C=C/C6=CC=C(O)C=C6)=O)CC[C@@](C(O)=O)5CC[C@](C)4[C@@](C)3CC[C@@]12[H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zamanic-acid.html |