Cefazolin
A semisynthetic cephalosporin analog with broad-spectrum antibiotic action due to inhibition of bacterial cell wall synthesis. It attains high serum levels and is excreted quickly via the urine.
| Catalog Number | INT25953199 |
| Alternative Name(s) | Cephazolin Cefazoline Cephamezine |
| Research Area | Intermediates |
| Molecular Formula | C14H14N8O4S3 |
| CAS# | 25953-19-9 |
| SMILES | CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=NN=N4)SC2)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/cefazolin-item-12570.html |