CP 31398 2HCl 25mg
CP 31398 2HCl has been shown to act as a stabilizing agent for p53, and to promotes activity of p53 in cancer cell lines.
| Trivial name | CP 31398 2HCl 25mg |
| Catalog Number | A13522-25 |
| Alternative Name(s) | N'-[2-[2-(4-Methoxyphenyl)ethenyl]-4-quinazolinyl]-N,N-dimethyl-1,3-propanediaminedihydrochloride |
| Molecular Formula | C22H26N4O.2ClH |
| CAS# | 259199-65-0 |
| SMILES | CN(C)CCCNC1=NC(=NC2=CC=CC=C21)/C=C/C3=CC=C(C=C3)OC.Cl.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/cp-31398-2hcl.html |