Xanthosine 5′-monophosphate sodium salt
Xanthosine 5′-monophosphate sodium salt (5′-Xanthylic acid sodium salt) is an intermediate in purine metabolism. Xanthosine 5′-monophosphate sodium salt can be used for genetic code, nucleic acid structure, and DNA, RNA and protein synthesis research.
| Trivial name | 5'-Xanthylic acid sodium salt |
| Catalog Number | E7280 |
| Molecular Formula | C32H36ClNO8 |
| CAS# | 25899-70-1 |
| Inchi | InChI=1S/C26H28ClNO.C6H8O7/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-16H,17-20H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) /b26-25-; |
| Inchi Key | IWEQQRMGNVVKQW-OQKDUQJOSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)C(=C(CCCl)C2=CC=CC=C2)C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/xanthosine-5-monophosphate-sodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7280-xanthosine-5-monophosphate-sodium-salt-chemical-structure-tube.png |
