Lacto-N-neodifucohexaose II | MedChemExpress (MCE)
Lacto-N-neodifucohexaose II (Compd 9) is a derivative of key human milk tetrasaccharide[1]. Lacto-N-neodifucohexaose II is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.
| Trivial name | Lacto-N-neodifucohexaose II |
| Catalog Number | HY-N11454 |
| Alternative Name(s) | LNnDFH II |
| Research Area | Metabolic Disease |
| CAS# | 2583908-45-4 |
| Purity | ≥98.00% |
| SMILES | OC[C@@H]([C@H]([C@H]([C@@H]1O)O)O)O[C@@H]1O[C@@H]([C@@H](O[C@@H]([C@H]2NC(C)=O)O[C@H]3[C@@H]([C@H](O[C@H]([C@H]3O)CO)O[C@@H]4[C@H]([C@@H]([C@H](O[C@H]4CO)OCCCCCCN=[N+]=[N-])O)O[C@@H]5[C@@H]([C@H]([C@H]([C@H](O5)C)O)O)O)O)CO)[C@H]2O[C@@H]6[C@@H]([C@H]([C@H]([C@H](O6)C)O)O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lacto-n-neodifucohexaose-ii.html |