Mal-cyclohexane-Gly-Gly-Phe-Gly-Exatecan | MedChemExpress (MCE)
Mal-cyclohexane-Gly-Gly-Phe-Gly-Exatecan is a coupling compound that can be used for the synthesis of ADC. Mal-cyclohexane-Gly-Gly-Phe-Gly-Exatecan synthesized ADC shows good antitumor activity in vitro and in vivo[1].
| Trivial name | Mal-cyclohexane-Gly-Gly-Phe-Gly-Exatecan |
| Catalog Number | HY-153067 |
| Research Area | Cancer |
| CAS# | 2578019-72-2 |
| Purity | ≥98.00% |
| SMILES | O=C(C1CCC(CC1)CN2C(C=CC2=O)=O)NCC(NCC(N[C@@H](CC3=CC=CC=C3)C(NCC(NCO[C@@H](C)C(N[C@@H]4C5=C6C(C(N7C6)=CC([C@](O)(C(OC8)=O)CC)=C8C7=O)=NC9=CC(F)=C(C)C(CC4)=C95)=O)=O)=O)=O)=O |
| PubChem Chemical Structure ID | 168006947 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mal-cyclohexane-gly-gly-phe-gly-exatecan.html |