VD4162 | MedChemExpress (MCE)
VD4162 (Compound 8b) is a macrocyclic inhibitor of serine proteases. VD4162 can significantly improve potency for all four target enzymes TMPRSS2 (IC50 = 3.7 nM), HGFA(IC50 = 3.3 nM), matriptase (IC50 = 2.9 nM), and hepsin (IC50 = 0.54 nM). VD4162 can be used for the research of cancer[1].

Trivial name | VD4162 |
Catalog Number | HY-161370 |
Research Area | Cancer |
CAS# | 2574390-19-3 |
Purity | ≥98.0% |
SMILES | O=C1[C@@H](CC2=CNC3=C2C=CC=C3)NC([C@H](CC4=CC=C(OCCCC[C@@H](C(N[C@H](C(C5=NC6=C(C=CC=C6)S5)=O)CCCNC(N)=N)=O)N1)C=C4)NC(C)=O)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/vd4162.html |