Terizidone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02468 |
| Alternative Name(s) | 4,4'-((1,4-phenylenebis(methanylylidene))bis(azanylylidene))bis(isoxazolidin-3-one) |
| Research Area | Terizidone is a broad spectrum antibiotic used as a second-line antitubercular drug, effective against pulmonary and extrapulmonary tuberculosis. Terizidone has activity against Mycobacterium strains that are resistant to first-line drugs. |
| Molecular Formula | C14H14N4O4 |
| CAS# | 25683-71-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C(CON1)/N=C/C2=CC=C(/C=N/C(CON3)C3=O)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02468.html |
| Additional Information | NULL |