Methyl arachidonate
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30658 |
| Alternative Name(s) | ARcHIDONc cID METHYL ESTER |
| Research Area | Arachidonic Acid Methyl Ester is the methyl ester derivative of Arachidonic Acid and is shown to exhibit strong antimicrobial activity against oral microorganisms. Also used for preventing and treating gastric disorders. |
| Molecular Formula | C21H34O2 |
| CAS# | 2566-89-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OC)CCC/C=CC/C=CC/C=CC/C=CCCCCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30658.html |
| Additional Information | NULL |