Rivenprost | MedChemExpress (MCE)
Rivenprost (ONO-4819; ONO-AE1-734) is a selective agonist for prostaglandin E receptor EP4 with Ki of 0.7 nM. Rivenprost exhibits hepatoprotective and bone anabolic effects[1][2].
| Trivial name | Rivenprost |
| Catalog Number | HY-114974 |
| Alternative Name(s) | ONO-4819; ONO-AE1-734 |
| Research Area | Inflammation/Immunology; Others |
| CAS# | 256382-08-8 |
| Purity | ≥98.0% |
| SMILES | COCC1=CC=CC(C[C@H](O)/C=C/[C@@H]2[C@H](C(C[C@H]2O)=O)CCSCCCC(OC)=O)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rivenprost.html |