Glutor | MedChemExpress (MCE)
Glutor is a selective GLUT 1/2/3 inhibitor that can inhibit glucose uptake. Glutor can inhibit glycolysis and effectively induce the death of cancer cells cultured in monolayers and spheroids[1].
| Trivial name | Glutor |
| Catalog Number | HY-158302 |
| Research Area | Cancer |
| CAS# | 2561471-22-3 |
| Purity | ≥98.0% |
| SMILES | O=C([C@@]1(C)N(C(C2=CC(C3=CC=CC=C3)=NN2C1)=O)CC(C=C4)=CC=C4N5CCOCC5)NCC6=CC=CN=C6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/glutor.html |