Demethyleneberberine
Demethyleneberberine (DMB), a component of Cortex Phellodendri Chinensis (CPC), significantly alleviates the weight loss and diminishes myeloperoxidase (MPO) activity, while significantly reduces the production of pro-inflammatory cytokines, such as interleukin (IL)-6 and tumor necrosis factor-α (TNF-α), and inhibits the activation of NF-κB signaling pathway. Demethyleneberberine (DMB) potentially ameliorates NAFLD (Non-alcoholic fatty liver disease) by activating AMPK pathways.
Trivial name | DMB |
Catalog Number | S3299 |
Molecular Formula | C19H18NO4 |
CAS# | 25459-91-0 |
SMILES | COC1=C(OC)C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(O)C=C4CC3)O |
Size | 1mg |
Supplier Page | http://www.selleckchem.com/products/demethyleneberberine.html |
Additional Information | https://file.selleck.cn/downloads/struct/s3299-demethyleneberberine-chemical-structure.gif |