DCC-3116 | MedChemExpress (MCE)
DCC-3116 is an orally active ULK1/2 inhibitor. DCC-3116 can promote autophagy in lung cancer cells by inhibiting KRASG12C signaling, thereby inhibiting the proliferation of lung cancer cells and exerting anti-cancer effects[1].
| Trivial name | DCC-3116 |
| Catalog Number | HY-160699 |
| Research Area | Cancer |
| CAS# | 2543673-19-2 |
| Purity | ≥98.0% |
| SMILES | O=C1N(CCCNC2=NC(NC3=CC=C(N4CCN(CC4)C)C=C3CC)=NC=C2C(F)(F)F)CCOCC1 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/dcc-3116.html |