Levothyroxine Sodium
API Standard
| Catalog Number | CS-O-01770 |
| Alternative Name(s) | Thyroxine (T4);sodium (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate;Levothyroxine Sodium; Thyrax Sodium; Thyreoideum Sodium |
| Research Area | One of the thyroid hormones involved in the maintenance of metabolic homeostasis. Synthesized and stored as amino acid residues of thyroglobulin, the major protein component of the thyroid follicular colloid. |
| Molecular Formula | C15H10I4NNaO4 |
| CAS# | 25416-65-3 |
| Purity | >98% |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)[O-])N.[Na+] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01770.html |
