Formothion
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-16780 |
| Alternative Name(s) | Anthio;Aflix Antio;Anthio 25 |
| Research Area | Formothion is an organophosphate insecticide which is used on various fruit trees, and vines to control the various insects. These compound is able to control spider mites, psyllids, aphids, mealy bugs, jassids, whiteflies, leaf miners, ermine moths and fruit flies. |
| Molecular Formula | C6H12NO4PS2 |
| CAS# | 2540-82-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C=O)C(=O)CSP(=S)(OC)OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16780.html |
| Additional Information | NULL |