Kanamycin Sulfate
Kanamycin A Sulfate is the sulfate salt form of kanamycin A, the major component of the kanamycin complex, an aminoglycoside antibiotic isolated from Streptomyces kanamyceticus, with antibacterial activity.
| Catalog Number | API25389940 |
| Alternative Name(s) | Kanamycin A sulfate Kanamycin monosulfate Kanamycin (sulfate) |
| Research Area | Antibiotic APIs |
| Molecular Formula | C18H38N4O15S |
| CAS# | 25389-94-0 |
| SMILES | C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/kanamycin-sulfate-item-11862.html |