Hydroxy Bosentan
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-10316 |
| Alternative Name(s) | 4-(2-Hydroxy-1,1-dimethylethyl)-N-[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)[2,2'-bipyrimidin]-4-yl]-benzenesulfonamide |
| Research Area | The active metabolite of Bosentan, a mixed endothelin receptor antagonist which is used as a vasodilator. |
| Molecular Formula | C27H29N5O7S |
| CAS# | 253688-60-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=C(C=CC=C1)OC(C(N[S](=O)(C2=CC=C(C(C)(C)CO)C=C2)=O)=NC(C3=NC=CC=N3)=N4)=C4OCCO |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10316.html |
| Additional Information | NULL |