Wiskostatin 10mg
Wiskostatin is a cell-permeable N-alkylated carbazole derivative that selectively blocks actin filament assembly. The compound acts as a selective, reversible inhibitor of N-WASP (neural Wiskott Aldrich syndrome protein), a signal integrating protein. Wiskostatin also binds to N-WASP, stabilize the autoinhibited conformation and prevent the activation of Arp2/3 (actin-related protein 2/3) complex.
| Trivial name | Wiskostatin 10mg |
| Catalog Number | A13903-10 |
| Alternative Name(s) | 3,6-Dibromo-??-[(dimethylamino)methyl]-9H-cabazole-9-ethanol |
| Molecular Formula | C17H18Br2N2O |
| CAS# | 253449-04-6 |
| SMILES | CN(C)CC(CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/wiskostatin.html |
