Trazodone Hydrochloride
API Standard
| Catalog Number | CS-O-05402 |
| Alternative Name(s) | 2-(3-(4-(3chlorophenyl)piperazin-1-yl)propyl)-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one |
| Research Area | Trazodone hydrochloride is a serotonin uptake inhibitor that is used as an antidepressive agent. It has been shown to be effective in patients with major depressive disorders and other subsets of depressive disorders. It is generally more useful in depres |
| Molecular Formula | C19H2Cl2N5O |
| CAS# | 25332-39-2 |
| Purity | >98% |
| SMILES | O=C1N(C=CC=C2)C2=NN1CCCN3CCN(C4=CC(Cl)=CC=C4)CC3.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05402.html |