Doxorubicin HCl
Doxorubicin HCl is an antibiotic agent that inhibits DNA topoisomerase II and induces DNA damage and apoptosis in tumor cells.
| Trivial name | NSC 123127; Adriamycin; Hydroxydaunorubicin HCl |
| Catalog Number | CSN16255 |
| Alternative Name(s) | NSC 123127; Adriamycin; Hydroxydaunorubicin HCl |
| Research Area | Cancer |
| Molecular Formula | C27H30ClNO11 |
| CAS# | 25316-40-9 |
| Purity | ≥99% |
| SMILES | Cl[H].COC1=CC=CC2=C1C(C3=C(C(O)=C4C[C@](C[C@@H](C4=C3O)O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)N)(C(CO)=O)O)C2=O)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/doxorubicin-hcl.html |
