HBC620
HBC620 is an analogue of HBC which is a GFP fluorophore-like synthetic dye that is nonfluorescent in solution, but strongly fluoresces upon forming tight complex with Pepper RNA aptamer. HBC-Pepper complex can be used to visualize RNA dynamics in live cells.
| Catalog Number | E0623 |
| Molecular Formula | C16H11N3 |
| CAS# | 2530162-07-1 |
| SMILES | N#C\C(=C/C1=CN=CC=C1)C2=C[NH]C3=CC=CC=C23 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/hbc620.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0623-hbc620-chemical-structure.png |
