CHIR-98014
CHIR-98014 (CT98014) is highly selective aminopyrimidine-derivatived inhibitor of GSK-3 with IC50 of 650nM and 580nM for GSK-3 and GSK-3(measured by kinase assays), respectively, and exhibits >1000-fold selectivity for GSK-3 over closely related kinases, such as cdc2.
| Trivial name | / |
| Catalog Number | CSN23355 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C20H17Cl2N9O2 |
| CAS# | 252935-94-7 |
| Purity | ≥98% |
| SMILES | NC1=C([N+]([O-])=O)C=CC(NCCNC2=NC=C(N3C=CN=C3)C(C4=CC=C(Cl)C=C4Cl)=N2)=N1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/chir-98014.html |
