Taurocholic Acid D4 Sodium Salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15089 |
| Alternative Name(s) | 2-((R)-4-((3R,5S,7R,8R,9S,10R,12S,13R,14S,17R)-3,7,12-trihydroxy-2,2,4,4,10,13-hexamethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamido)ethanesulfonic acid, sodium salt D4 |
| Research Area | Labeled Taurocholic Acid, intended for use as an internal standard for the quantification of Taurocholic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C26H40D4NNaO7S |
| CAS# | 252030-90-3 (free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H](C[C@@](C([2H])([2H])[C@H](O)C([2H])([2H])C1)([H])[C@@]1(C)[C@@]2([H])C[C@@H]3O)[C@@]2([H])[C@@](CC[C@]4([H])[C@H](C)CCC(NCC[S](=O)([O-])=O)=O)([H])[C@]34C.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15089.html |
| Additional Information | NULL |