Mesalazine EP Impurity M
2-Chloro-5-nitrobenzoic Acid is used in the synthesis of sesquiterpenoids as potential antibacterial compounds. Also used in the synthesis of substituted phenyl oxazoles as novel LSD1 inhibitors with antiproliferative activity. In addition its used to synthesize cathespin L inhibitors.;Impurity in commercial preparations of Mesalazine
| Catalog Number | CS-O-31125 |
| Alternative Name(s) | MESALAZINE EP IMPURITY M;2-Chloro-5-nitrobenzoic Acid;2-Chloro-5-nitrobenzoic acid;Mesalamine EP Impurity M. |
| Molecular Formula | C7H4ClNO4 |
| CAS# | 2516-96-3 |
| Purity | >98% |
| SMILES | OC(C1=CC([N](=O)=O)=CC=C1Cl)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31125.html |