O(6)-NPE-Morpholino G(iBu) succinate, TEA salt

O(6)-NPE-Morpholino G(iBu) succinate, TEA salt is an essential component within the biomedicine industry, providing researchers with an invaluable tool for designing versatile oligonucleotides capable of inhibiting the expression of various target genes implicated in important pathologies like cancer. Its unique molecular structure allows for improved stability and specificity when compared to traditional nucleotide analogs, whilst simultaneously providing a new level of sophistication. Incorporating this monomer into various DNA or RNA molecules allows for the effective attainment of specific gene knockdown, hence the reason for its introduction in numerous preclinical studies.

Catalog Number PIPB-0390
Alternative Name(s) Morpholino o6-(p-nitrophenethyl) g monomer SCHEMBL25792149 EX-A5918 (6-(2-Isobutyramido-6-(4-nitrophenethoxy)-9H-purin-9-yl)-4-tritylmorpholin-2-yl)methyl dimethylphosphoramidochloridate
Research Area PMO Succinate
Molecular Formula C43H46ClN8O7P
CAS# 2504201-88-9
SMILES CC(C)C(=O)NC1=NC2=C(C(=N1)OCCC3=CC=C(C=C3)[N+](=O)[O-])N=CN2C4CN(CC(O4)COP(=O)(N(C)C)Cl)C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7
Size inquiry
Supplier Page https://www.protheragen-ing.com/o6-npe-morpholino-gibu-succinate-tea-salt-item-10508.html