LC-2
LC-2 is the first PROTAC capable of degrading endogenous KRAS(G12C). It covalently binds KRASG12C with a MRTX849 warhead and recruits the E3 ligase VHL, inducing rapid and sustained KRASG12C degradation leading to suppression of MAPK signaling in both homozygous and heterozygous KRASG12C cell lines.
| Trivial name | / |
| Catalog Number | CSN27182 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C59H71ClFN11O7S |
| CAS# | 2502156-03-6 |
| Purity | ≥98% |
| SMILES | ClC1=CC=CC2=C1C(N3CCC4=C(N5CCN(C(C(F)=C)=O)[C@@H](CC#N)C5)N=C(OC[C@@H]6CCCN6CCCOCCC(N[C@@H](C(C)(C)C)C(N7[C@H](C(NCC8=CC=C(C9=C(C)N=CS9)C=C8)=O)C[C@@H](O)C7)=O)=O)N=C4C3)=CC=C2 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/lc-2.html |