Justicidin A | MedChemExpress (MCE)
justicidin A is a nature product that could be isolated form Justicia procumbens. justicidin A decreases the level of Ku70 leading to translocation of Bax from the cytosol to mitochondria to induce apoptosis. justicidin A can be used in research of cancer[1].
| Trivial name | Justicidin A |
| Catalog Number | HY-117078 |
| Research Area | Cancer |
| CAS# | 25001-57-4 |
| Purity | ≥98.00% |
| SMILES | O=C1OCC2=C(OC)C3=CC(OC)=C(OC)C=C3C(C4=CC=C(OCO5)C5=C4)=C12 |
| PubChem Chemical Structure ID | 159982 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/justicidin-a.html |