GMB-475
GMB-475 is a degrader of BCR-ABL1 tyrosine kinase based on PROTAC, overcoming BCR-ABL1-dependent drug resistance. GMB-475 reduced viability and increased apoptosis in primary CML CD34+ cells, with no effect on healthy CD34+ cells at identical concentrations.
| Trivial name | / |
| Catalog Number | CSN25549 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C43H46F3N7O7S |
| CAS# | 2489876-37-9 |
| Purity | ≥99% |
| SMILES | FC(F)(OC1=CC=C(C=C1)NC2=CC(C3=CC=C(C=C3)OCCOCC(N[C@H](C(N4[C@@H](C[C@H](C4)O)C(NCC5=CC=C(C=C5)C6=C(N=CS6)C)=O)=O)C(C)(C)C)=O)=NC=N2)F |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/gmb-475.html |