ω-3 Arachidonic acid | MedChemExpress (MCE)
ω-3 Arachidonic acid is a poly fatty acid that is essential for growth and development in infants. ω-3 Arachidonic acid inhibits arachidenol-CoA synthetase with Ki values of 14 µM. It also inhibited arachidenol-CoA synthetase of calf brain extract with IC50 values of about 5 µM[1][2].
| Trivial name | ω-3 Arachidonic acid |
| Catalog Number | HY-125140 |
| Research Area | Others |
| CAS# | 24880-40-8 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ω-3-arachidonic-acid.html |