α-Hydroxyglutaric acid-d4 disodium | MedChemExpress (MCE)
α-Hydroxyglutaric acid-d4 (disodium) is the deuterium labeled α-Hydroxyglutaric acid disodium[1]. α-Hydroxyglutaric acid (2-Hydroxyglutarate) disodium is an α-hydroxy acid form of glutaric acid. α-Hydroxyglutaric acid disodium is a competitive inhibitor of multiple α-ketoglutarate-dependent dioxygenases, including histone demethylases and the TET family of 5-methlycytosine (5mC) hydroxylases[2].
| Trivial name | α-Hydroxyglutaric acid-d4 disodium |
| Catalog Number | HY-113038AS1 |
| Alternative Name(s) | 2-Hydroxyglutarate-d4 disodium; 2-Hydroxyglutaric acid-d4 disodium; 2-Hydroxypentanedioic acid-d4 disodium |
| Research Area | Cancer |
| CAS# | 2483831-91-8 |
| Purity | ≥98.00% |
| SMILES | O=C(O[Na])CC([2H])([2H])C(O[2H])([2H])C(O[Na])=O |
| PubChem Chemical Structure ID | 168006839 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-hydroxyglutaric-acid-d4-disodium.html |