α-Hydroxyglutaric acid-13C5 disodium | MedChemExpress (MCE)
α-Hydroxyglutaric acid-13C5 (sodium) is the 13C labeled α-Hydroxyglutaric acid sodium[1]. α-Hydroxyglutaric acid (2-Hydroxyglutarate) sodium is an α-hydroxy acid form of glutaric acid. α-Hydroxyglutaric acid sodium is a competitive inhibitor of multiple α-ketoglutarate-dependent dioxygenases, including histone demethylases and the TET family of 5-methlycytosine (5mC) hydroxylases[2].
| Trivial name | α-Hydroxyglutaric acid-13C5 disodium |
| Catalog Number | HY-113038AS |
| Alternative Name(s) | 2-Hydroxyglutarate-13C5 disodium; 2-Hydroxyglutaric acid-13C5 sodium; 2-Hydroxypentanedioic acid-13C5 disodium |
| Research Area | Cancer |
| CAS# | 2482467-23-0 |
| Purity | 99.80% |
| SMILES | O=[13C](O[Na])[13CH2][13CH2][13CH](O)[13C](O[Na])=O |
| PubChem Chemical Structure ID | 168006838 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-hydroxyglutaric-acid-13c5-sodium.html |