Acetosyringone
Acetosyringone is a phenolic natural product secreted by wounded plant tissues, is widely used to increase efficacy of genetic transformation for the creation of genetically modified dicotyledonous and monocotyledonous plants.
| Trivial name | 3',5'-Dimethoxy-4'-hydroxyacetophenone |
| Catalog Number | CSN23296 |
| Alternative Name(s) | 3',5'-Dimethoxy-4'-hydroxyacetophenone |
| Research Area | / |
| Molecular Formula | C10H12O4 |
| CAS# | 2478-38-8 |
| Purity | ≥99% |
| SMILES | CC(C1=CC(OC)=C(O)C(OC)=C1)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/acetosyringone.html |
