Thyrotropin-Releasing Hormone (TRH), Free Acid
Thyrotropin-releasing hormone (TRH) is an endogenous tripeptide that acts as a neurotransmitter and neurohormone. TRH regulates hypothalamic-pituitary-adrenal (HPA) and estrogenic signaling pathways. TRH exhibits immunomodulatory and neuroprotective activities. TRH prevents oxidative stress, caspase-mediated apoptosis, glutamate toxicity, and neuroinflammation. Additionally, TRH stimulates epidermal regeneration in ex vivo models, increasing would healing. TRH activates the TRH receptor.
| Catalog Number | R1836 |
| Alternative Name(s) | TRH | Thyroliberin | Thyrotropin-releasing hormone | Prothyroliberin |
| Molecular Formula | C16H21N5O5 |
| CAS# | 24769-58-2 |
| Purity | >95% |
| Inchi | InChI=1S/C16H21N5O5/c22-13-4-3-10(19-13)14(23)20-11(6-9-7-17-8-18-9)15(24)21-5-1-2-12(21)16(25)26/h7-8,10-12H,1-6H2,(H,17,18)(H,19,22)(H,20,23)(H,25,26)/t10-,11-,12-/m0/s1 |
| Inchi Key | ITYONPBTNRIEBA-SRVKXCTJSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CC2=CN=CN2)NC(=O)[C@@H]3CCC(=O)N3)C(=O)O |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/thyrotropin-releasing-hormone-trh-free-acid-item-r1836-39371.html |