6-Methoxy-2-naphthoic acid (Standard) | MedChemExpress (MCE)
6-Methoxy-2-naphthoic acid (Standard) is the analytical standard of 6-Methoxy-2-naphthoic acid. This product is intended for research and analytical applications. 6-Methoxy-2-naphthoic acid is an NMDA receptor modulator extracted from patent WO 2012019106 A2.
| Trivial name | 6-Methoxy-2-naphthoic acid (Standard) |
| Catalog Number | HY-B2121R |
| Alternative Name(s) | Naproxen impurity O (Standard) |
| Research Area | Neurological Disease |
| CAS# | 2471-70-7 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C2C=C(OC)C=CC2=C1)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6-methoxy-2-naphthoic-acid-standard.html |