Catharanthine
Catharanthine showed muscarinic antagonism at 10 μM and fully inhibited nicotinic receptor mediated diaphragm contractions with an IC50 of 59.6 μM. As a precursor of the anti-tumor drugs vinblastine and vincristine, it also works as an inhibitor of tubulin self-assembly into microtubules.
| Trivial name | (+)-3,4-Didehydrocoronaridine |
| Catalog Number | CSN16245 |
| Alternative Name(s) | (+)-3,4-Didehydrocoronaridine |
| Research Area | Neurological Disease |
| Molecular Formula | C21H24N2O2 |
| CAS# | 2468-21-5 |
| Purity | ≥98% |
| SMILES | CCC1=C[C@@]2([H])C[C@]([C@]1([H])[N@@](C2)CC3)(C(OC)=O)C4=C3C5=CC=CC=C5N4 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/catharanthine.html |
