Elsinochrome A | MedChemExpress (MCE)
Elsinochrome A is a perylene quinone photosensitizer, and can generate reactive oxygen species (ROS) to induce apoptosis and autophagy under light excitation. Elsinochrome A also shows antifungal activity against C. albicans biofilm through photodynamic antimicrobial chemotherapy (PACT). Elsinochrome A can be used for research of photodynamic therapy (PDT) (Ex: 460 nm)[1][2].
| Trivial name | Elsinochrome A |
| Catalog Number | HY-N10611 |
| Research Area | Infection; Cancer |
| CAS# | 24568-67-0 |
| Purity | ≥98.0% |
| SMILES | CC([C@H]1C(C2=C(C3=C(C=C4OC)O)C4=C(C(OC)=CC(O)=C56)C5=C2C([C@@H]1C(C)=O)=C(OC)C6=O)=C(OC)C3=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/elsinochrome-a.html |