Keap1-Nrf2-IN-15 | MedChemExpress (MCE)
Keap1-Nrf2-IN-15 (Compound 24a) is a potent Keap1-Nrf2 protein-protein interaction inhibitor with IC50s of 77 nM and 2.5 nM in FP assay and TR-FRET assay, respectively[1].
| Trivial name | Keap1-Nrf2-IN-15 |
| Catalog Number | HY-149245 |
| Research Area | Inflammation/Immunology |
| CAS# | 2456295-45-5 |
| Purity | ≥98.00% |
| SMILES | COC1=CC=C(C=C1)S(=O)(N(C2=CC(CCCN3C(C4=C(C3=O)C=CC=C4)=O)=C(C5=CC=CC=C52)N(S(=O)(C6=CC=C(C=C6)OC)=O)CC(O)=O)CC(O)=O)=O |
| PubChem Chemical Structure ID | 155007330 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/keap1-nrf2-in-15.html |