Dihexa acetate
Dihexa is a blood-brain barrier-permeable angiotensin IV analog which exhibits high affinity to HGF with Kd value of 65pM and induces c-Met phosphorylation in the presence of subthreshold concentrations of HGF and augment HGF-dependent cell scattering.
| Trivial name | / |
| Catalog Number | CSN24316 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C29H48N4O7 |
| CAS# | 2453297-24-8 |
| Purity | ≥97% |
| SMILES | O=C(CCCCC)N[C@@H](CC1=CC=C(O)C=C1)C(N[C@H](C(NCCCCCC(N)=O)=O)[C@H](CC)C)=O.CC(O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dihexa-acetate.html |