Mavacamten-d6 | MedChemExpress (MCE)
Mavacamten-d6 (MYK461-d6; SAR439152-d6) is deuterium labeled Mavacamten (HY-109037). Mavacamten (MYK461) is an orally active modulator of cardiac myosin, with IC50s of 490, 711 nM for bovine cardiac and human cardiac, respectively.
| Trivial name | Mavacamten-d6 |
| Catalog Number | HY-109037S |
| Alternative Name(s) | MYK461-d6; SAR439152-d6 |
| Research Area | Cardiovascular Disease |
| CAS# | 2453251-18-6 |
| Purity | ≥98.00% |
| SMILES | [2H]C([2H])([2H])C(N1C(C=C(NC1=O)N[C@H](C2=CC=CC=C2)C)=O)C([2H])([2H])[2H] |
| PubChem Chemical Structure ID | 151733781 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mavacamten-d6.html |