Mavacamten-d5 | MedChemExpress (MCE)
Mavacamten-d5 (MYK461-d5; SAR439152-d5) is deuterium labeled Mavacamten (HY-109037). Mavacamten (MYK461) is an orally active modulator of cardiac myosin, with IC50s of 490, 711 nM for bovine cardiac and human cardiac, respectively.
| Trivial name | Mavacamten-d5 |
| Catalog Number | HY-109037S3 |
| Alternative Name(s) | MYK461-d5; SAR439152-d5 |
| Research Area | Cardiovascular Disease |
| CAS# | 2453251-00-6 |
| Purity | 98.61% |
| SMILES | CC(N1C(C=C(NC1=O)N[C@H](C2=C([2H])C([2H])=C([2H])C([2H])=C2[2H])C)=O)C |
| PubChem Chemical Structure ID | 151733783 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mavacamten-d5.html |