Geniposide 10mM * 1mL in DMSO
Geniposide is an iridoid glycoside with a variety of biological activities including neuroprotective, anti-diabetic, antiproliferative, and antioxidative activity.
| Trivial name | Geniposide 10mM * 1mL in DMSO |
| Catalog Number | A11735-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C17H24O10 |
| CAS# | 24512-63-8 |
| SMILES | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1CC=C2CO)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/geniposide.html |
