BMS-986365 | MedChemExpress (MCE)
BMS-986365 is a selective heterobifunctional ligand-directed degrader (LDD) targeting the androgen receptor (AR). BMS-986365 demonstrated significant in vivo potency, degrading AR, inhibiting AR signaling, and inhibiting tumor growth in animal models of advanced prostate cancer.
| Trivial name | BMS-986365 |
| Catalog Number | HY-158101 |
| Alternative Name(s) | CC-94676 |
| Research Area | Cancer |
| CAS# | 2446928-30-7 |
| Purity | 99.9% |
| SMILES | N#CC1=C(C(F)(F)F)C=C(N2C(N(C3=CC=C(OCCN4C[C@@H](C)N(CC(NC5=CC=CC(NC6C(NC(CC6)=O)=O)=C5)=O)CC4)C(CC)=C3)C(C)(C)C2=O)=S)C=C1 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/bms-986365.html |