Mcl-1 inhibitor 12 | MedChemExpress (MCE)
Mcl-1 inhibitor 12 (Example 10) is a MCL-1 inhibitor (Ki: 0.22 nM). Mcl-1 inhibitor 12 can be used for the research of cancers[1].
| Trivial name | Mcl-1 inhibitor 12 |
| Catalog Number | HY-153423 |
| Research Area | Cancer |
| CAS# | 2445466-24-8 |
| Purity | ≥98.00% |
| SMILES | COC1=CC=CC=C1C2=NC(COC3=C(C[C@H](C(O)=O)OC4=NC=NN5C4=[C@]([C@]6=C(C)C(Cl)=C(OCCN7CCN(C)CC7)C=C6)C(C8=CC=C(F)C=C8)=C5)C=CC=C3)=CC=N2 |
| PubChem Chemical Structure ID | 154938832 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mcl-1-inhibitor-12.html |