Ethyl 4-Methoxycinnamate
A natural product with diverse actions; inhibits COX-1 and COX-2 in vitro (IC50s = 1.12 and 0.83 μM, respectively); reduces IL-1 and TNF-a production in vivo; inhibits granuloma tissue formation in a dose-dependent manner in rats; inhibits blood vessel gr
| Trivial name | / |
| Catalog Number | CSN24869 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C12H14O3 |
| CAS# | 24393-56-4 |
| Purity | ≥97% |
| SMILES | O=C(OCC)/C=C/C1=CC=C(OC)C=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ethyl-4-methoxycinnamate.html |