KSDSC | MedChemExpress (MCE)
KSDSC is a penta-peptide, correlated positively with hairpin DNA with tetramer loops. Therefore, KSDSC joins hands with hairpin DNA (hpDNA) with improved selectivity as sensing materials in the detection system, used for surface plasmon resonance imaging (SPRi)[1].
| Trivial name | KSDSC |
| Catalog Number | HY-P5228 |
| Research Area | Others |
| CAS# | 2439064-83-0 |
| Purity | ≥98.00% |
| SMILES | OC([C@H](CS)NC([C@H](CO)NC([C@H](CC(O)=O)NC([C@H](CO)NC([C@@H](N)CCCCN)=O)=O)=O)=O)=O |
| PubChem Chemical Structure ID | 168432166 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ksdsc.html |