(+)-Mepivacaine | MedChemExpress (MCE)
(+)-Mepivacaine is a racemic isomer of Mepivacaine (HY-B0517), which has analgesic and vasoconstrictive activity. Mepivacaine is an amide type agent that temporarily causes local loss of consciousness. Mepivacaine binds to specific voltage-gated sodium channels on neuronal cell membranes, inhibiting sodium influx and membrane depolarization[1].
| Trivial name | (+)-Mepivacaine |
| Catalog Number | HY-119961 |
| Alternative Name(s) | Dexivacaine; (S)-Mepivacaine |
| Research Area | Cardiovascular Disease |
| CAS# | 24358-84-7 |
| Purity | 99.72% |
| SMILES | O=C(NC1=C(C=CC=C1C)C)[C@H]2N(CCCC2)C |
| PubChem Chemical Structure ID | 3032799 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/plus-mepivacaine.html |