K-80001 | MedChemExpress (MCE)
K-80001 is an RXRα-binder and COX-1/2 inhibitor, with IC50s of with an IC50 of 82.9μM, 3.4μM, 1.2μM for RXRα, COX-1 and COX-2, respectively[1].
| Trivial name | K-80001 |
| Catalog Number | HY-153980 |
| Research Area | Inflammation/Immunology |
| CAS# | 242800-40-4 |
| Purity | ≥98.00% |
| SMILES | OC(CC1=C(C)/C(C2=CC=C(F)C=C21)=C/C3=CC=C(C=C3)C)=O |
| PubChem Chemical Structure ID | 9839585 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/k-80001.html |