Benzophenonetetracarboxylic dianhydride | MedChemExpress (MCE)
Benzophenonetetracarboxylic dianhydride is widely used in the synthesis of high-performance polyimides and other polymer materials. Benzophenonetetracarboxylic dianhydride reacts with various diamine compounds to form oligoimide chains. These oligimide chains can modify graphene oxide (Go) and enhance its properties[1].

Trivial name | Benzophenonetetracarboxylic dianhydride |
Catalog Number | HY-W009169 |
Alternative Name(s) | BTDA |
Research Area | Others |
CAS# | 2421-28-5 |
Purity | ≥98.0% |
SMILES | O=C(C1=CC2=C(C(OC2=O)=O)C=C1)C3=CC4=C(C(OC4=O)=O)C=C3 |
Size | 25 g |
Supplier Page | https://www.medchemexpress.com/benzophenonetetracarboxylic-dianhydride.html |