Epiyangambin
Epiyangambin, a natural phytotoxic lignan isolated and purified from the twigs of Hernandia ovigera. with anti-platelet aggregation activity, exhibits significant inhibition of the transformation of murine epidermal JB6 cells, with the IC50 value of 0.15 mg/mL.
| Trivial name | / |
| Catalog Number | CSN14373 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C24H30O8 |
| CAS# | 24192-64-1 |
| Purity | ≥98% |
| SMILES | COC1=C(OC)C(OC)=CC([C@H]2OC[C@]3([H])[C@H](C4=CC(OC)=C(OC)C(OC)=C4)OC[C@@]32[H])=C1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/epiyangambin.html |